C18H31N — CID 57104097
(3aS,3bR,9aS,9bR,11aS)-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-naphtho[2,1-e]indole (PubChem CID 57104097) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (3aS,3bR,9aS,9bR,11aS)-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-naphtho[2,1-e]indole.
| Compound Name | (3aS,3bR,9aS,9bR,11aS)-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-naphtho[2,1-e]indole |
|---|---|
| PubChem CID | 57104097 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (3aS,3bR,9aS,9bR,11aS)-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-naphtho[2,1-e]indole |
| SMILES | C[C@]12CCCCC1CC[C@@H]1[C@H]2CC[C@]2(C)NCC[C@@H]12 |
| InChI | InChI=1S/C18H31N/c1-17-10-4-3-5-13(17)6-7-14-15(17)8-11-18(2)16(14)9-12-19-18/h13-16,19H,3-12H2,1-2H3/t13?,14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | YXBYTYZISOMVSD-BHSGIXCHSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |