C13H21NO2 — CID 57104896
2-pentyl-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 57104896) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-pentyl-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-pentyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 57104896 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-pentyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | CCCCCn1c(O)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C13H21NO2/c1-2-3-6-9-14-12(15)10-7-4-5-8-11(10)13(14)16/h15-16H,2-9H2,1H3 |
| InChIKey | ABONRNQCQIAHRW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|