C28H32N3O+ — CID 57106261
[phenyl(pyridin-3-yl)methylidene]-propyl-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propanoylamino]azanium (PubChem CID 57106261) has the molecular formula C28H32N3O+ and a molecular weight of 426.58 g/mol. Its IUPAC name is [phenyl(pyridin-3-yl)methylidene]-propyl-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propanoylamino]azanium.
| Compound Name | [phenyl(pyridin-3-yl)methylidene]-propyl-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propanoylamino]azanium |
|---|---|
| PubChem CID | 57106261 |
| Molecular Formula | C28H32N3O+ |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | [phenyl(pyridin-3-yl)methylidene]-propyl-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)propanoylamino]azanium |
| SMILES | CCC[N+](NC(=O)CCC1CCCc2ccccc21)=C(c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C28H31N3O/c1-2-20-31(28(24-11-4-3-5-12-24)25-15-9-19-29-21-25)30-27(32)18-17-23-14-8-13-22-10-6-7-16-26(22)23/h3-7,9-12,15-16,19,21,23H,2,8,13-14,17-18,20H2,1H3/p+1 |
| InChIKey | RSJMYQQBWOTZDP-UHFFFAOYSA-O |
| XLogP | 5.27 |
| TPSA | 45.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|