About 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol
3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol (PubChem CID 57107386) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol.
Analyze 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol?
The IUPAC name of 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol (CID 57107386) is 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol is CNCCC1=CC=CC(O)C1O.
What is the InChIKey of 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol?
The InChIKey is QBRNKKXZYBWVES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-10-6-5-7-3-2-4-8(11)9(7)12/h2-4,8-12H,5-6H2,1H3.
What are the key properties of 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol?
3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol has a molecular weight of 169.22 g/mol, XLogP of -0.19, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 57107386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).