C20H28Cl2N2O — CID 57108112
6-[(3,4-dichlorophenyl)methylidene]-N-[2-(diethylamino)ethoxy]-2-methylcyclohexen-1-amine (PubChem CID 57108112) has the molecular formula C20H28Cl2N2O and a molecular weight of 383.36 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methylidene]-N-[2-(diethylamino)ethoxy]-2-methylcyclohexen-1-amine.
| Compound Name | 6-[(3,4-dichlorophenyl)methylidene]-N-[2-(diethylamino)ethoxy]-2-methylcyclohexen-1-amine |
|---|---|
| PubChem CID | 57108112 |
| Molecular Formula | C20H28Cl2N2O |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methylidene]-N-[2-(diethylamino)ethoxy]-2-methylcyclohexen-1-amine |
| SMILES | CCN(CC)CCONC1=C(C)CCCC1=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H28Cl2N2O/c1-4-24(5-2)11-12-25-23-20-15(3)7-6-8-17(20)13-16-9-10-18(21)19(22)14-16/h9-10,13-14,23H,4-8,11-12H2,1-3H3 |
| InChIKey | YIEYEFQELOSPCL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|