C21H31ClN2O — CID 56976968
1-(4-chlorophenyl)-N-(3-piperidin-1-ylpropoxy)hepta-1,3-dien-3-amine (PubChem CID 56976968) has the molecular formula C21H31ClN2O and a molecular weight of 362.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(3-piperidin-1-ylpropoxy)hepta-1,3-dien-3-amine.
| Compound Name | 1-(4-chlorophenyl)-N-(3-piperidin-1-ylpropoxy)hepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 56976968 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.94 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(3-piperidin-1-ylpropoxy)hepta-1,3-dien-3-amine |
| SMILES | CCCC=C(C=Cc1ccc(Cl)cc1)NOCCCN1CCCCC1 |
| InChI | InChI=1S/C21H31ClN2O/c1-2-3-8-21(14-11-19-9-12-20(22)13-10-19)23-25-18-7-17-24-15-5-4-6-16-24/h8-14,23H,2-7,15-18H2,1H3 |
| InChIKey | CWTFIBLTRWLBJQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.94 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|