C20H29ClN2O2 — CID 57023903
(2R)-1-(butylamino)-3-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxypropan-2-ol (PubChem CID 57023903) has the molecular formula C20H29ClN2O2 and a molecular weight of 364.92 g/mol. Its IUPAC name is (2R)-1-(butylamino)-3-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxypropan-2-ol.
| Compound Name | (2R)-1-(butylamino)-3-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 57023903 |
| Molecular Formula | C20H29ClN2O2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (2R)-1-(butylamino)-3-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxypropan-2-ol |
| SMILES | CCCCNC[C@@H](O)CONC1=CCCCC1=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H29ClN2O2/c1-2-3-12-22-14-19(24)15-25-23-20-7-5-4-6-17(20)13-16-8-10-18(21)11-9-16/h7-11,13,19,22-24H,2-6,12,14-15H2,1H3/t19-/m1/s1 |
| InChIKey | ADTIHQNWQQQYON-LJQANCHMSA-N |
| XLogP | 4.06 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|