C21H29Cl2N3O2 — CID 56985877
(2S)-1-[[6-[(2,6-dichlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol (PubChem CID 56985877) has the molecular formula C21H29Cl2N3O2 and a molecular weight of 426.39 g/mol. Its IUPAC name is (2S)-1-[[6-[(2,6-dichlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol.
| Compound Name | (2S)-1-[[6-[(2,6-dichlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 56985877 |
| Molecular Formula | C21H29Cl2N3O2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (2S)-1-[[6-[(2,6-dichlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol |
| SMILES | CN1CCN(C[C@H](O)CONC2=CCCCC2=Cc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C21H29Cl2N3O2/c1-25-9-11-26(12-10-25)14-17(27)15-28-24-21-8-3-2-5-16(21)13-18-19(22)6-4-7-20(18)23/h4,6-8,13,17,24,27H,2-3,5,9-12,14-15H2,1H3/t17-/m0/s1 |
| InChIKey | WRIMGUDUVFDFMI-KRWDZBQOSA-N |
| XLogP | 3.57 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|