C18H25ClN2O2 — CID 57131035
(2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(dimethylamino)propan-2-ol (PubChem CID 57131035) has the molecular formula C18H25ClN2O2 and a molecular weight of 336.86 g/mol. Its IUPAC name is (2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(dimethylamino)propan-2-ol.
| Compound Name | (2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 57131035 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(dimethylamino)propan-2-ol |
| SMILES | CN(C)C[C@@H](O)CONC1=CCCCC1=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H25ClN2O2/c1-21(2)12-17(22)13-23-20-18-6-4-3-5-15(18)11-14-7-9-16(19)10-8-14/h6-11,17,20,22H,3-5,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | XZCYETRZHSIZGM-QGZVFWFLSA-N |
| XLogP | 3.23 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|