C19H27ClN2O2 — CID 57048294
(2S)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(propylamino)propan-2-ol (PubChem CID 57048294) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is (2S)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(propylamino)propan-2-ol.
| Compound Name | (2S)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(propylamino)propan-2-ol |
|---|---|
| PubChem CID | 57048294 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (2S)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-(propylamino)propan-2-ol |
| SMILES | CCCNC[C@H](O)CONC1=CCCCC1=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H27ClN2O2/c1-2-11-21-13-18(23)14-24-22-19-6-4-3-5-16(19)12-15-7-9-17(20)10-8-15/h6-10,12,18,21-23H,2-5,11,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | SCBYVQZXKUJAAU-SFHVURJKSA-N |
| XLogP | 3.67 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|