C22H33N3O3 — CID 57070557
(1S,2R)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-1-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol (PubChem CID 57070557) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is (1S,2R)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-1-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (1S,2R)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-1-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 57070557 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (1S,2R)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-1-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)[C@H](ONC1=CCCCC1=Cc1ccccc1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C22H33N3O3/c1-18(27)22(25-13-11-24(12-14-25)15-16-26)28-23-21-10-6-5-9-20(21)17-19-7-3-2-4-8-19/h2-4,7-8,10,17-18,22-23,26-27H,5-6,9,11-16H2,1H3/t18-,22+/m1/s1 |
| InChIKey | GQZBWRMJNVEDQK-GCJKJVERSA-N |
| XLogP | 1.98 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|