C21H32N2O — CID 56616499
6-benzylidene-N-[2-[di(propan-2-yl)amino]ethoxy]cyclohexen-1-amine (PubChem CID 56616499) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is 6-benzylidene-N-[2-[di(propan-2-yl)amino]ethoxy]cyclohexen-1-amine.
| Compound Name | 6-benzylidene-N-[2-[di(propan-2-yl)amino]ethoxy]cyclohexen-1-amine |
|---|---|
| PubChem CID | 56616499 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 6-benzylidene-N-[2-[di(propan-2-yl)amino]ethoxy]cyclohexen-1-amine |
| SMILES | CC(C)N(CCONC1=CCCCC1=Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H32N2O/c1-17(2)23(18(3)4)14-15-24-22-21-13-9-8-12-20(21)16-19-10-6-5-7-11-19/h5-7,10-11,13,16-18,22H,8-9,12,14-15H2,1-4H3 |
| InChIKey | OHHPJHGJABHLSU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|