C24H37FN2O — CID 56975572
N-[2-(dimethylamino)ethoxy]-6-[(4-fluorophenyl)methylidene]-2-heptylcyclohexen-1-amine (PubChem CID 56975572) has the molecular formula C24H37FN2O and a molecular weight of 388.57 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethoxy]-6-[(4-fluorophenyl)methylidene]-2-heptylcyclohexen-1-amine.
| Compound Name | N-[2-(dimethylamino)ethoxy]-6-[(4-fluorophenyl)methylidene]-2-heptylcyclohexen-1-amine |
|---|---|
| PubChem CID | 56975572 |
| Molecular Formula | C24H37FN2O |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | N-[2-(dimethylamino)ethoxy]-6-[(4-fluorophenyl)methylidene]-2-heptylcyclohexen-1-amine |
| SMILES | CCCCCCCC1=C(NOCCN(C)C)C(=Cc2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C24H37FN2O/c1-4-5-6-7-8-10-21-11-9-12-22(19-20-13-15-23(25)16-14-20)24(21)26-28-18-17-27(2)3/h13-16,19,26H,4-12,17-18H2,1-3H3 |
| InChIKey | IJECJTGFINEHAR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|