C20H30N2O — CID 56613452
8-benzylidene-N-[3-(dimethylamino)propoxy]cycloocten-1-amine (PubChem CID 56613452) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 8-benzylidene-N-[3-(dimethylamino)propoxy]cycloocten-1-amine.
| Compound Name | 8-benzylidene-N-[3-(dimethylamino)propoxy]cycloocten-1-amine |
|---|---|
| PubChem CID | 56613452 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 8-benzylidene-N-[3-(dimethylamino)propoxy]cycloocten-1-amine |
| SMILES | CN(C)CCCONC1=CCCCCCC1=Cc1ccccc1 |
| InChI | InChI=1S/C20H30N2O/c1-22(2)15-10-16-23-21-20-14-9-4-3-8-13-19(20)17-18-11-6-5-7-12-18/h5-7,11-12,14,17,21H,3-4,8-10,13,15-16H2,1-2H3 |
| InChIKey | FUFNQFXOWZPAIG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|