C31H42FN3O — CID 57239588
N-[2-[(2R)-2-benzylpiperazin-1-yl]ethoxy]-6-[(4-fluorophenyl)methylidene]-2-pentylcyclohexen-1-amine (PubChem CID 57239588) has the molecular formula C31H42FN3O and a molecular weight of 491.70 g/mol. Its IUPAC name is N-[2-[(2R)-2-benzylpiperazin-1-yl]ethoxy]-6-[(4-fluorophenyl)methylidene]-2-pentylcyclohexen-1-amine.
| Compound Name | N-[2-[(2R)-2-benzylpiperazin-1-yl]ethoxy]-6-[(4-fluorophenyl)methylidene]-2-pentylcyclohexen-1-amine |
|---|---|
| PubChem CID | 57239588 |
| Molecular Formula | C31H42FN3O |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.33 |
| IUPAC Name | N-[2-[(2R)-2-benzylpiperazin-1-yl]ethoxy]-6-[(4-fluorophenyl)methylidene]-2-pentylcyclohexen-1-amine |
| SMILES | CCCCCC1=C(NOCCN2CCNC[C@H]2Cc2ccccc2)C(=Cc2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C31H42FN3O/c1-2-3-5-11-27-12-8-13-28(22-26-14-16-29(32)17-15-26)31(27)34-36-21-20-35-19-18-33-24-30(35)23-25-9-6-4-7-10-25/h4,6-7,9-10,14-17,22,30,33-34H,2-3,5,8,11-13,18-21,23-24H2,1H3/t30-/m1/s1 |
| InChIKey | RAFCFWLCCUBOAY-SSEXGKCCSA-N |
| XLogP | 6.27 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|