C22H32N2O3 — CID 57066574
(2S)-1-[(8-benzylidenecycloocten-1-yl)amino]oxy-3-morpholin-4-ylpropan-2-ol (PubChem CID 57066574) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is (2S)-1-[(8-benzylidenecycloocten-1-yl)amino]oxy-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[(8-benzylidenecycloocten-1-yl)amino]oxy-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 57066574 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | (2S)-1-[(8-benzylidenecycloocten-1-yl)amino]oxy-3-morpholin-4-ylpropan-2-ol |
| SMILES | O[C@H](CONC1=CCCCCCC1=Cc1ccccc1)CN1CCOCC1 |
| InChI | InChI=1S/C22H32N2O3/c25-21(17-24-12-14-26-15-13-24)18-27-23-22-11-7-2-1-6-10-20(22)16-19-8-4-3-5-9-19/h3-5,8-9,11,16,21,23,25H,1-2,6-7,10,12-15,17-18H2/t21-/m0/s1 |
| InChIKey | ZFYZFELRTFTJDU-NRFANRHFSA-N |
| XLogP | 3.13 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|