C21H32N2O2 — CID 57089043
(2S)-1-[(5-benzylidenecyclopenten-1-yl)amino]oxy-3-[di(propan-2-yl)amino]propan-2-ol (PubChem CID 57089043) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (2S)-1-[(5-benzylidenecyclopenten-1-yl)amino]oxy-3-[di(propan-2-yl)amino]propan-2-ol.
| Compound Name | (2S)-1-[(5-benzylidenecyclopenten-1-yl)amino]oxy-3-[di(propan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 57089043 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (2S)-1-[(5-benzylidenecyclopenten-1-yl)amino]oxy-3-[di(propan-2-yl)amino]propan-2-ol |
| SMILES | CC(C)N(C[C@H](O)CONC1=CCCC1=Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H32N2O2/c1-16(2)23(17(3)4)14-20(24)15-25-22-21-12-8-11-19(21)13-18-9-6-5-7-10-18/h5-7,9-10,12-13,16-17,20,22,24H,8,11,14-15H2,1-4H3/t20-/m0/s1 |
| InChIKey | CQSAGZNNMGROMO-FQEVSTJZSA-N |
| XLogP | 3.75 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|