C23H33ClN2O2 — CID 57070555
(2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-[cyclohexyl(methyl)amino]propan-2-ol (PubChem CID 57070555) has the molecular formula C23H33ClN2O2 and a molecular weight of 404.98 g/mol. Its IUPAC name is (2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-[cyclohexyl(methyl)amino]propan-2-ol.
| Compound Name | (2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-[cyclohexyl(methyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 57070555 |
| Molecular Formula | C23H33ClN2O2 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-[cyclohexyl(methyl)amino]propan-2-ol |
| SMILES | CN(C[C@@H](O)CONC1=CCCCC1=Cc1ccc(Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C23H33ClN2O2/c1-26(21-8-3-2-4-9-21)16-22(27)17-28-25-23-10-6-5-7-19(23)15-18-11-13-20(24)14-12-18/h10-15,21-22,25,27H,2-9,16-17H2,1H3/t22-/m1/s1 |
| InChIKey | UGNKQHYTRDHHED-JOCHJYFZSA-N |
| XLogP | 4.94 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|