C28H36N2O2 — CID 56997237
(2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-(4-benzylpiperidin-1-yl)propan-2-ol (PubChem CID 56997237) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is (2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-(4-benzylpiperidin-1-yl)propan-2-ol.
| Compound Name | (2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-(4-benzylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 56997237 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | (2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-(4-benzylpiperidin-1-yl)propan-2-ol |
| SMILES | O[C@H](CONC1=CCCCC1=Cc1ccccc1)CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H36N2O2/c31-27(21-30-17-15-25(16-18-30)19-23-9-3-1-4-10-23)22-32-29-28-14-8-7-13-26(28)20-24-11-5-2-6-12-24/h1-6,9-12,14,20,25,27,29,31H,7-8,13,15-19,21-22H2/t27-/m0/s1 |
| InChIKey | XWCLTLFXJZBJJD-MHZLTWQESA-N |
| XLogP | 4.97 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|