C27H32N2O2 — CID 57103808
(2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propan-2-ol (PubChem CID 57103808) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is (2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propan-2-ol.
| Compound Name | (2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 57103808 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | (2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propan-2-ol |
| SMILES | O[C@H](CONC1=CCCCC1=Cc1ccccc1)CN1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N2O2/c30-26(20-29-17-15-24(16-18-29)23-11-5-2-6-12-23)21-31-28-27-14-8-7-13-25(27)19-22-9-3-1-4-10-22/h1-6,9-12,14-15,19,26,28,30H,7-8,13,16-18,20-21H2/t26-/m0/s1 |
| InChIKey | QSCTZFNRNIDKBS-SANMLTNESA-N |
| XLogP | 4.81 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|