C19H28N2O2 — CID 57115842
(2S)-1-[(5-benzylidenecyclopenten-1-yl)amino]oxy-3-(tert-butylamino)propan-2-ol (PubChem CID 57115842) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2S)-1-[(5-benzylidenecyclopenten-1-yl)amino]oxy-3-(tert-butylamino)propan-2-ol.
| Compound Name | (2S)-1-[(5-benzylidenecyclopenten-1-yl)amino]oxy-3-(tert-butylamino)propan-2-ol |
|---|---|
| PubChem CID | 57115842 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (2S)-1-[(5-benzylidenecyclopenten-1-yl)amino]oxy-3-(tert-butylamino)propan-2-ol |
| SMILES | CC(C)(C)NC[C@H](O)CONC1=CCCC1=Cc1ccccc1 |
| InChI | InChI=1S/C19H28N2O2/c1-19(2,3)20-13-17(22)14-23-21-18-11-7-10-16(18)12-15-8-5-4-6-9-15/h4-6,8-9,11-12,17,20-22H,7,10,13-14H2,1-3H3/t17-/m0/s1 |
| InChIKey | NEAFUBGEMYYYAY-KRWDZBQOSA-N |
| XLogP | 3.02 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|