C21H30N2O3 — CID 57143156
(2S)-1-[(7-benzylidenecyclohepten-1-yl)amino]oxy-3-morpholin-4-ylpropan-2-ol (PubChem CID 57143156) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2S)-1-[(7-benzylidenecyclohepten-1-yl)amino]oxy-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[(7-benzylidenecyclohepten-1-yl)amino]oxy-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 57143156 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (2S)-1-[(7-benzylidenecyclohepten-1-yl)amino]oxy-3-morpholin-4-ylpropan-2-ol |
| SMILES | O[C@H](CONC1=CCCCCC1=Cc1ccccc1)CN1CCOCC1 |
| InChI | InChI=1S/C21H30N2O3/c24-20(16-23-11-13-25-14-12-23)17-26-22-21-10-6-2-5-9-19(21)15-18-7-3-1-4-8-18/h1,3-4,7-8,10,15,20,22,24H,2,5-6,9,11-14,16-17H2/t20-/m0/s1 |
| InChIKey | GHGVMIRZPMJSIG-FQEVSTJZSA-N |
| XLogP | 2.74 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|