C22H33ClN2O2 — CID 57214904
(2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-[di(propan-2-yl)amino]propan-2-ol (PubChem CID 57214904) has the molecular formula C22H33ClN2O2 and a molecular weight of 392.97 g/mol. Its IUPAC name is (2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-[di(propan-2-yl)amino]propan-2-ol.
| Compound Name | (2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-[di(propan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 57214904 |
| Molecular Formula | C22H33ClN2O2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2R)-1-[[6-[(4-chlorophenyl)methylidene]cyclohexen-1-yl]amino]oxy-3-[di(propan-2-yl)amino]propan-2-ol |
| SMILES | CC(C)N(C[C@@H](O)CONC1=CCCCC1=Cc1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C22H33ClN2O2/c1-16(2)25(17(3)4)14-21(26)15-27-24-22-8-6-5-7-19(22)13-18-9-11-20(23)12-10-18/h8-13,16-17,21,24,26H,5-7,14-15H2,1-4H3/t21-/m1/s1 |
| InChIKey | YLVGRTAJQRDHQO-OAQYLSRUSA-N |
| XLogP | 4.79 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|