C20H30N2O — CID 57011050
1-phenyl-N-(3-piperidin-1-ylpropoxy)hexa-1,3-dien-3-amine (PubChem CID 57011050) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-phenyl-N-(3-piperidin-1-ylpropoxy)hexa-1,3-dien-3-amine.
| Compound Name | 1-phenyl-N-(3-piperidin-1-ylpropoxy)hexa-1,3-dien-3-amine |
|---|---|
| PubChem CID | 57011050 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 1-phenyl-N-(3-piperidin-1-ylpropoxy)hexa-1,3-dien-3-amine |
| SMILES | CCC=C(C=Cc1ccccc1)NOCCCN1CCCCC1 |
| InChI | InChI=1S/C20H30N2O/c1-2-10-20(14-13-19-11-5-3-6-12-19)21-23-18-9-17-22-15-7-4-8-16-22/h3,5-6,10-14,21H,2,4,7-9,15-18H2,1H3 |
| InChIKey | KTNIGPIFNSBEGD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|