C18H27N3O — CID 57019463
N-[3-(4-methylpiperazin-1-yl)propoxy]-4-phenylbuta-1,3-dien-2-amine (PubChem CID 57019463) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propoxy]-4-phenylbuta-1,3-dien-2-amine.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propoxy]-4-phenylbuta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 57019463 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propoxy]-4-phenylbuta-1,3-dien-2-amine |
| SMILES | C=C(C=Cc1ccccc1)NOCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C18H27N3O/c1-17(9-10-18-7-4-3-5-8-18)19-22-16-6-11-21-14-12-20(2)13-15-21/h3-5,7-10,19H,1,6,11-16H2,2H3 |
| InChIKey | ZLQJWNRVOPPADZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|