C21H31ClN2O — CID 57018728
1-(4-chlorophenyl)-6-methyl-N-(3-pyrrolidin-1-ylpropoxy)hepta-1,3-dien-3-amine (PubChem CID 57018728) has the molecular formula C21H31ClN2O and a molecular weight of 362.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-methyl-N-(3-pyrrolidin-1-ylpropoxy)hepta-1,3-dien-3-amine.
| Compound Name | 1-(4-chlorophenyl)-6-methyl-N-(3-pyrrolidin-1-ylpropoxy)hepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 57018728 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-(4-chlorophenyl)-6-methyl-N-(3-pyrrolidin-1-ylpropoxy)hepta-1,3-dien-3-amine |
| SMILES | CC(C)CC=C(C=Cc1ccc(Cl)cc1)NOCCCN1CCCC1 |
| InChI | InChI=1S/C21H31ClN2O/c1-18(2)6-12-21(13-9-19-7-10-20(22)11-8-19)23-25-17-5-16-24-14-3-4-15-24/h7-13,18,23H,3-6,14-17H2,1-2H3 |
| InChIKey | JJDNWJNEYBZGJA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|