C19H29ClN2O2 — CID 57076175
(2R)-1-[[1-(4-chlorophenyl)-6-methylhepta-1,3-dien-3-yl]amino]oxy-3-(dimethylamino)propan-2-ol (PubChem CID 57076175) has the molecular formula C19H29ClN2O2 and a molecular weight of 352.91 g/mol. Its IUPAC name is (2R)-1-[[1-(4-chlorophenyl)-6-methylhepta-1,3-dien-3-yl]amino]oxy-3-(dimethylamino)propan-2-ol.
| Compound Name | (2R)-1-[[1-(4-chlorophenyl)-6-methylhepta-1,3-dien-3-yl]amino]oxy-3-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 57076175 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2R)-1-[[1-(4-chlorophenyl)-6-methylhepta-1,3-dien-3-yl]amino]oxy-3-(dimethylamino)propan-2-ol |
| SMILES | CC(C)CC=C(C=Cc1ccc(Cl)cc1)NOC[C@H](O)CN(C)C |
| InChI | InChI=1S/C19H29ClN2O2/c1-15(2)5-11-18(21-24-14-19(23)13-22(3)4)12-8-16-6-9-17(20)10-7-16/h6-12,15,19,21,23H,5,13-14H2,1-4H3/t19-/m1/s1 |
| InChIKey | QJSMLPKCDQMQOO-LJQANCHMSA-N |
| XLogP | 3.73 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|