C20H28Cl2N2O2 — CID 57097626
(2S)-1-(butylamino)-3-[[6-[(3,4-dichlorophenyl)methylidene]cyclohexen-1-yl]amino]oxypropan-2-ol (PubChem CID 57097626) has the molecular formula C20H28Cl2N2O2 and a molecular weight of 399.36 g/mol. Its IUPAC name is (2S)-1-(butylamino)-3-[[6-[(3,4-dichlorophenyl)methylidene]cyclohexen-1-yl]amino]oxypropan-2-ol.
| Compound Name | (2S)-1-(butylamino)-3-[[6-[(3,4-dichlorophenyl)methylidene]cyclohexen-1-yl]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 57097626 |
| Molecular Formula | C20H28Cl2N2O2 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2S)-1-(butylamino)-3-[[6-[(3,4-dichlorophenyl)methylidene]cyclohexen-1-yl]amino]oxypropan-2-ol |
| SMILES | CCCCNC[C@H](O)CONC1=CCCCC1=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H28Cl2N2O2/c1-2-3-10-23-13-17(25)14-26-24-20-7-5-4-6-16(20)11-15-8-9-18(21)19(22)12-15/h7-9,11-12,17,23-25H,2-6,10,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | RBECVULELYOPMO-KRWDZBQOSA-N |
| XLogP | 4.72 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|