About hexyl 2-(thiolan-2-yl)acetate
hexyl 2-(thiolan-2-yl)acetate (PubChem CID 57108501) has the molecular formula C12H22O2S
and a molecular weight of 230.37 g/mol. Its IUPAC name is hexyl 2-(thiolan-2-yl)acetate.
Molecular Properties
| Compound Name | hexyl 2-(thiolan-2-yl)acetate |
| PubChem CID | 57108501 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | hexyl 2-(thiolan-2-yl)acetate |
| SMILES | CCCCCCOC(=O)CC1CCCS1 |
| InChI | InChI=1S/C12H22O2S/c1-2-3-4-5-8-14-12(13)10-11-7-6-9-15-11/h11H,2-10H2,1H3 |
| InChIKey | HUTCICVRUGABRJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 2-(thiolan-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 2-(thiolan-2-yl)acetate?
The IUPAC name of hexyl 2-(thiolan-2-yl)acetate (CID 57108501) is hexyl 2-(thiolan-2-yl)acetate.
What is the SMILES notation for hexyl 2-(thiolan-2-yl)acetate?
The canonical SMILES for hexyl 2-(thiolan-2-yl)acetate is CCCCCCOC(=O)CC1CCCS1.
What is the InChIKey of hexyl 2-(thiolan-2-yl)acetate?
The InChIKey is HUTCICVRUGABRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2S/c1-2-3-4-5-8-14-12(13)10-11-7-6-9-15-11/h11H,2-10H2,1H3.
What are the key properties of hexyl 2-(thiolan-2-yl)acetate?
hexyl 2-(thiolan-2-yl)acetate has a molecular weight of 230.37 g/mol, XLogP of 3.40, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 2-(thiolan-2-yl)acetate is sourced from PubChem (CID 57108501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).