About cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate
cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate (PubChem CID 57109387) has the molecular formula C13H25NS5
and a molecular weight of 355.69 g/mol. Its IUPAC name is cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate.
Molecular Properties
| Compound Name | cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate |
| PubChem CID | 57109387 |
| Molecular Formula | C13H25NS5 |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate |
| SMILES | CC(C)SN(SC(C)C)C(=S)SSC1CCCCC1 |
| InChI | InChI=1S/C13H25NS5/c1-10(2)16-14(17-11(3)4)13(15)19-18-12-8-6-5-7-9-12/h10-12H,5-9H2,1-4H3 |
| InChIKey | INVKCNWOKPZFMH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate?
The IUPAC name of cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate (CID 57109387) is cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate.
What is the SMILES notation for cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate?
The canonical SMILES for cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate is CC(C)SN(SC(C)C)C(=S)SSC1CCCCC1.
What is the InChIKey of cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate?
The InChIKey is INVKCNWOKPZFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NS5/c1-10(2)16-14(17-11(3)4)13(15)19-18-12-8-6-5-7-9-12/h10-12H,5-9H2,1-4H3.
What are the key properties of cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate?
cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate has a molecular weight of 355.69 g/mol, XLogP of 6.40, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate is sourced from PubChem (CID 57109387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).