C13H25NS5 — CID 57109387
cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate (PubChem CID 57109387) has the molecular formula C13H25NS5 and a molecular weight of 355.69 g/mol. Its IUPAC name is cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate.
| Compound Name | cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate |
|---|---|
| PubChem CID | 57109387 |
| Molecular Formula | C13H25NS5 |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | cyclohexylsulfanyl N,N-bis(propan-2-ylsulfanyl)carbamodithioate |
| SMILES | CC(C)SN(SC(C)C)C(=S)SSC1CCCCC1 |
| InChI | InChI=1S/C13H25NS5/c1-10(2)16-14(17-11(3)4)13(15)19-18-12-8-6-5-7-9-12/h10-12H,5-9H2,1-4H3 |
| InChIKey | INVKCNWOKPZFMH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|