C25H33FN4O2 — CID 57110006
tert-butyl N-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methylamino]butan-2-yl]-N-methylcarbamate (PubChem CID 57110006) has the molecular formula C25H33FN4O2 and a molecular weight of 440.56 g/mol. Its IUPAC name is tert-butyl N-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methylamino]butan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methylamino]butan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 57110006 |
| Molecular Formula | C25H33FN4O2 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | tert-butyl N-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methylamino]butan-2-yl]-N-methylcarbamate |
| SMILES | CC(CCNCc1nc2ccccc2n1Cc1ccc(F)cc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H33FN4O2/c1-18(29(5)24(31)32-25(2,3)4)14-15-27-16-23-28-21-8-6-7-9-22(21)30(23)17-19-10-12-20(26)13-11-19/h6-13,18,27H,14-17H2,1-5H3 |
| InChIKey | HPKMICZCEKTXIJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|