C18H28N4O2 — CID 57116484
tert-butyl N-[4-(1H-benzimidazol-2-ylmethylamino)butan-2-yl]-N-methylcarbamate (PubChem CID 57116484) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is tert-butyl N-[4-(1H-benzimidazol-2-ylmethylamino)butan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-(1H-benzimidazol-2-ylmethylamino)butan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 57116484 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl N-[4-(1H-benzimidazol-2-ylmethylamino)butan-2-yl]-N-methylcarbamate |
| SMILES | CC(CCNCc1nc2ccccc2[nH]1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N4O2/c1-13(22(5)17(23)24-18(2,3)4)10-11-19-12-16-20-14-8-6-7-9-15(14)21-16/h6-9,13,19H,10-12H2,1-5H3,(H,20,21) |
| InChIKey | GFPWBQVIKFNLBW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|