C29H36N4O3 — CID 139971978
tert-butyl 2-[7-[[3-(1H-benzimidazol-2-ylmethylamino)propanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetate (PubChem CID 139971978) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is tert-butyl 2-[7-[[3-(1H-benzimidazol-2-ylmethylamino)propanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetate.
| Compound Name | tert-butyl 2-[7-[[3-(1H-benzimidazol-2-ylmethylamino)propanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetate |
|---|---|
| PubChem CID | 139971978 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | tert-butyl 2-[7-[[3-(1H-benzimidazol-2-ylmethylamino)propanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CC(CNC(=O)CCNCc2nc3ccccc3[nH]2)=CCc2ccccc21 |
| InChI | InChI=1S/C29H36N4O3/c1-29(2,3)36-28(35)17-22-16-20(12-13-21-8-4-5-9-23(21)22)18-31-27(34)14-15-30-19-26-32-24-10-6-7-11-25(24)33-26/h4-12,22,30H,13-19H2,1-3H3,(H,31,34)(H,32,33) |
| InChIKey | FTHQGWHBOVQTHN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|