C25H27N3O3 — CID 142656526
2-[7-[[4-(1H-benzimidazol-2-yl)butanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid (PubChem CID 142656526) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[7-[[4-(1H-benzimidazol-2-yl)butanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid.
| Compound Name | 2-[7-[[4-(1H-benzimidazol-2-yl)butanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid |
|---|---|
| PubChem CID | 142656526 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[7-[[4-(1H-benzimidazol-2-yl)butanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid |
| SMILES | O=C(O)CC1CC(CNC(=O)CCCc2nc3ccccc3[nH]2)=CCc2ccccc21 |
| InChI | InChI=1S/C25H27N3O3/c29-24(11-5-10-23-27-21-8-3-4-9-22(21)28-23)26-16-17-12-13-18-6-1-2-7-20(18)19(14-17)15-25(30)31/h1-4,6-9,12,19H,5,10-11,13-16H2,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | JTHCNOIGBYMNMR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|