C25H28N4O3 — CID 22594342
2-[7-[[3-(1H-benzimidazol-2-ylmethylamino)propanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid (PubChem CID 22594342) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[7-[[3-(1H-benzimidazol-2-ylmethylamino)propanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid.
| Compound Name | 2-[7-[[3-(1H-benzimidazol-2-ylmethylamino)propanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid |
|---|---|
| PubChem CID | 22594342 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-[7-[[3-(1H-benzimidazol-2-ylmethylamino)propanoylamino]methyl]-8,9-dihydro-5H-benzo[7]annulen-9-yl]acetic acid |
| SMILES | O=C(O)CC1CC(CNC(=O)CCNCc2nc3ccccc3[nH]2)=CCc2ccccc21 |
| InChI | InChI=1S/C25H28N4O3/c30-24(11-12-26-16-23-28-21-7-3-4-8-22(21)29-23)27-15-17-9-10-18-5-1-2-6-20(18)19(13-17)14-25(31)32/h1-9,19,26H,10-16H2,(H,27,30)(H,28,29)(H,31,32) |
| InChIKey | CIKLHGAGEWRKHE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|