C20H34 — CID 57111687
9-[(E)-but-2-en-2-yl]-2,6,12-trimethyltrideca-2,6,11-triene (PubChem CID 57111687) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 9-[(E)-but-2-en-2-yl]-2,6,12-trimethyltrideca-2,6,11-triene.
| Compound Name | 9-[(E)-but-2-en-2-yl]-2,6,12-trimethyltrideca-2,6,11-triene |
|---|---|
| PubChem CID | 57111687 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 9-[(E)-but-2-en-2-yl]-2,6,12-trimethyltrideca-2,6,11-triene |
| SMILES | C/C=C(\C)C(CC=C(C)C)CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C20H34/c1-8-19(7)20(14-12-17(4)5)15-13-18(6)11-9-10-16(2)3/h8,10,12-13,20H,9,11,14-15H2,1-7H3/b18-13?,19-8+ |
| InChIKey | KHLKAWLEYSFMOO-CEMONOKNSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|