C12H30N6 — CID 57113550
1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-3-(1,3,5-triazinan-2-yl)propane-1,1,1-triamine (PubChem CID 57113550) has the molecular formula C12H30N6 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-3-(1,3,5-triazinan-2-yl)propane-1,1,1-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-3-(1,3,5-triazinan-2-yl)propane-1,1,1-triamine |
|---|---|
| PubChem CID | 57113550 |
| Molecular Formula | C12H30N6 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.25 |
| IUPAC Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-3-(1,3,5-triazinan-2-yl)propane-1,1,1-triamine |
| SMILES | CN(C)C(CCC1NCNCN1)(N(C)C)N(C)C |
| InChI | InChI=1S/C12H30N6/c1-16(2)12(17(3)4,18(5)6)8-7-11-14-9-13-10-15-11/h11,13-15H,7-10H2,1-6H3 |
| InChIKey | OIXCKEMRRZIHGZ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|