C10H14N4O2 — CID 57116415
5-methyl-1-(2-methylpropyl)-3H-purine-2,6-dione (PubChem CID 57116415) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 5-methyl-1-(2-methylpropyl)-3H-purine-2,6-dione.
| Compound Name | 5-methyl-1-(2-methylpropyl)-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 57116415 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 5-methyl-1-(2-methylpropyl)-3H-purine-2,6-dione |
| SMILES | CC(C)CN1C(=O)NC2=NC=NC2(C)C1=O |
| InChI | InChI=1S/C10H14N4O2/c1-6(2)4-14-8(15)10(3)7(11-5-12-10)13-9(14)16/h5-6H,4H2,1-3H3,(H,11,12,13,16) |
| InChIKey | VMMODRQGRFVJJJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |