C15H28O3 — CID 57117577
octyl 3-hydroxy-2-methylidenehexanoate (PubChem CID 57117577) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is octyl 3-hydroxy-2-methylidenehexanoate.
| Compound Name | octyl 3-hydroxy-2-methylidenehexanoate |
|---|---|
| PubChem CID | 57117577 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | octyl 3-hydroxy-2-methylidenehexanoate |
| SMILES | C=C(C(=O)OCCCCCCCC)C(O)CCC |
| InChI | InChI=1S/C15H28O3/c1-4-6-7-8-9-10-12-18-15(17)13(3)14(16)11-5-2/h14,16H,3-12H2,1-2H3 |
| InChIKey | BIGYYWMKKYPETR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|