C20H42N6O2 — CID 57118991
1-N'-ethyl-1-N",2-dimorpholin-4-yl-1-N'-piperidin-1-yl-1-N"-propylethane-1,1,1-triamine (PubChem CID 57118991) has the molecular formula C20H42N6O2 and a molecular weight of 398.60 g/mol. Its IUPAC name is 1-N'-ethyl-1-N",2-dimorpholin-4-yl-1-N'-piperidin-1-yl-1-N"-propylethane-1,1,1-triamine.
| Compound Name | 1-N'-ethyl-1-N",2-dimorpholin-4-yl-1-N'-piperidin-1-yl-1-N"-propylethane-1,1,1-triamine |
|---|---|
| PubChem CID | 57118991 |
| Molecular Formula | C20H42N6O2 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 1-N'-ethyl-1-N",2-dimorpholin-4-yl-1-N'-piperidin-1-yl-1-N"-propylethane-1,1,1-triamine |
| SMILES | CCCN(N1CCOCC1)C(N)(CN1CCOCC1)N(CC)N1CCCCC1 |
| InChI | InChI=1S/C20H42N6O2/c1-3-8-26(24-13-17-28-18-14-24)20(21,19-22-11-15-27-16-12-22)25(4-2)23-9-6-5-7-10-23/h3-19,21H2,1-2H3 |
| InChIKey | YRPLAHVIIDBLJD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|