C17H34N6O — CID 140995718
4-piperazin-1-yl-3-piperidin-1-yl-3-pyrrolidin-1-ylmorpholin-2-amine (PubChem CID 140995718) has the molecular formula C17H34N6O and a molecular weight of 338.50 g/mol. Its IUPAC name is 4-piperazin-1-yl-3-piperidin-1-yl-3-pyrrolidin-1-ylmorpholin-2-amine.
| Compound Name | 4-piperazin-1-yl-3-piperidin-1-yl-3-pyrrolidin-1-ylmorpholin-2-amine |
|---|---|
| PubChem CID | 140995718 |
| Molecular Formula | C17H34N6O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | 4-piperazin-1-yl-3-piperidin-1-yl-3-pyrrolidin-1-ylmorpholin-2-amine |
| SMILES | NC1OCCN(N2CCNCC2)C1(N1CCCCC1)N1CCCC1 |
| InChI | InChI=1S/C17H34N6O/c18-16-17(21-10-4-5-11-21,20-8-2-1-3-9-20)23(14-15-24-16)22-12-6-19-7-13-22/h16,19H,1-15,18H2 |
| InChIKey | RBVORLFLMCEQPJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 60.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |