C16H23N5O5 — CID 57120091
(2R,5R)-2-(hydroxymethyl)-5-[6-[(1-hydroxy-2-methylcyclopentyl)amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 57120091) has the molecular formula C16H23N5O5 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2R,5R)-2-(hydroxymethyl)-5-[6-[(1-hydroxy-2-methylcyclopentyl)amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(hydroxymethyl)-5-[6-[(1-hydroxy-2-methylcyclopentyl)amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 57120091 |
| Molecular Formula | C16H23N5O5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (2R,5R)-2-(hydroxymethyl)-5-[6-[(1-hydroxy-2-methylcyclopentyl)amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | CC1CCCC1(O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C(O)C1O |
| InChI | InChI=1S/C16H23N5O5/c1-8-3-2-4-16(8,25)20-13-10-14(18-6-17-13)21(7-19-10)15-12(24)11(23)9(5-22)26-15/h6-9,11-12,15,22-25H,2-5H2,1H3,(H,17,18,20)/t8?,9-,11?,12?,15-,16?/m1/s1 |
| InChIKey | LEYCASFLKRNWKH-FIPSSYHVSA-N |
| XLogP | -0.64 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|