C15H25NO2S — CID 57122019
[4-methyl-2-(2-methylpropyl)pentyl]-thiophen-2-ylcarbamic acid (PubChem CID 57122019) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is [4-methyl-2-(2-methylpropyl)pentyl]-thiophen-2-ylcarbamic acid.
| Compound Name | [4-methyl-2-(2-methylpropyl)pentyl]-thiophen-2-ylcarbamic acid |
|---|---|
| PubChem CID | 57122019 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | [4-methyl-2-(2-methylpropyl)pentyl]-thiophen-2-ylcarbamic acid |
| SMILES | CC(C)CC(CC(C)C)CN(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C15H25NO2S/c1-11(2)8-13(9-12(3)4)10-16(15(17)18)14-6-5-7-19-14/h5-7,11-13H,8-10H2,1-4H3,(H,17,18) |
| InChIKey | ZNRJTZDESNPZGW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |