C20H35NO4 — CID 57122320
ethyl (2S,5S)-6-cyclohexyl-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoate (PubChem CID 57122320) has the molecular formula C20H35NO4 and a molecular weight of 353.50 g/mol. Its IUPAC name is ethyl (2S,5S)-6-cyclohexyl-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoate.
| Compound Name | ethyl (2S,5S)-6-cyclohexyl-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoate |
|---|---|
| PubChem CID | 57122320 |
| Molecular Formula | C20H35NO4 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | ethyl (2S,5S)-6-cyclohexyl-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoate |
| SMILES | CCOC(=O)[C@@H](C)C=C[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H35NO4/c1-6-24-18(22)15(2)12-13-17(14-16-10-8-7-9-11-16)21-19(23)25-20(3,4)5/h12-13,15-17H,6-11,14H2,1-5H3,(H,21,23)/t15-,17+/m0/s1 |
| InChIKey | WQJCYIXOMQTXPQ-DOTOQJQBSA-N |
| XLogP | 4.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|