About (N-carbamoyl-3-methylanilino) 2-phenylacetate
(N-carbamoyl-3-methylanilino) 2-phenylacetate (PubChem CID 57122340) has the molecular formula C16H16N2O3
and a molecular weight of 284.32 g/mol. Its IUPAC name is (N-carbamoyl-3-methylanilino) 2-phenylacetate.
Molecular Properties
| Compound Name | (N-carbamoyl-3-methylanilino) 2-phenylacetate |
| PubChem CID | 57122340 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (N-carbamoyl-3-methylanilino) 2-phenylacetate |
| SMILES | Cc1cccc(N(OC(=O)Cc2ccccc2)C(N)=O)c1 |
| InChI | InChI=1S/C16H16N2O3/c1-12-6-5-9-14(10-12)18(16(17)20)21-15(19)11-13-7-3-2-4-8-13/h2-10H,11H2,1H3,(H2,17,20) |
| InChIKey | SUHHLSNBUKULBF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (N-carbamoyl-3-methylanilino) 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N-carbamoyl-3-methylanilino) 2-phenylacetate?
The IUPAC name of (N-carbamoyl-3-methylanilino) 2-phenylacetate (CID 57122340) is (N-carbamoyl-3-methylanilino) 2-phenylacetate.
What is the SMILES notation for (N-carbamoyl-3-methylanilino) 2-phenylacetate?
The canonical SMILES for (N-carbamoyl-3-methylanilino) 2-phenylacetate is Cc1cccc(N(OC(=O)Cc2ccccc2)C(N)=O)c1.
What is the InChIKey of (N-carbamoyl-3-methylanilino) 2-phenylacetate?
The InChIKey is SUHHLSNBUKULBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-12-6-5-9-14(10-12)18(16(17)20)21-15(19)11-13-7-3-2-4-8-13/h2-10H,11H2,1H3,(H2,17,20).
What are the key properties of (N-carbamoyl-3-methylanilino) 2-phenylacetate?
(N-carbamoyl-3-methylanilino) 2-phenylacetate has a molecular weight of 284.32 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (N-carbamoyl-3-methylanilino) 2-phenylacetate is sourced from PubChem (CID 57122340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).