C11H11NO — CID 57123992
5-ethenyl-3-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 57123992) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 5-ethenyl-3-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-ethenyl-3-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 57123992 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-ethenyl-3-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | C=CC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C11H11NO/c1-2-10-8-11(12-13-10)9-6-4-3-5-7-9/h2-8,10,12H,1H2 |
| InChIKey | BJBCRAZEXGEMHG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|