C11H14O5 — CID 57124322
3-(dihydroxymethylidene)-6-(1-hydroxybutylidene)cyclohexa-1,4-diene-1,4-diol (PubChem CID 57124322) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-(dihydroxymethylidene)-6-(1-hydroxybutylidene)cyclohexa-1,4-diene-1,4-diol.
| Compound Name | 3-(dihydroxymethylidene)-6-(1-hydroxybutylidene)cyclohexa-1,4-diene-1,4-diol |
|---|---|
| PubChem CID | 57124322 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-(dihydroxymethylidene)-6-(1-hydroxybutylidene)cyclohexa-1,4-diene-1,4-diol |
| SMILES | CCCC(O)=c1cc(O)c(=C(O)O)cc1O |
| InChI | InChI=1S/C11H14O5/c1-2-3-8(12)6-4-10(14)7(11(15)16)5-9(6)13/h4-5,12-16H,2-3H2,1H3 |
| InChIKey | ZQRPRVQARYXGRP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|