C10H12O2 — CID 54305950
2,5-dimethyl-3,6-dimethylidenecyclohexa-1,4-diene-1,4-diol (PubChem CID 54305950) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 2,5-dimethyl-3,6-dimethylidenecyclohexa-1,4-diene-1,4-diol.
| Compound Name | 2,5-dimethyl-3,6-dimethylidenecyclohexa-1,4-diene-1,4-diol |
|---|---|
| PubChem CID | 54305950 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2,5-dimethyl-3,6-dimethylidenecyclohexa-1,4-diene-1,4-diol |
| SMILES | C=c1c(C)c(O)c(=C)c(C)c1O |
| InChI | InChI=1S/C10H12O2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H,1,4H2,2-3H3 |
| InChIKey | SHMSPNQSODDPLJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|