C10H11ClO2 — CID 54074805
3-(chloromethylidene)-2,5-dimethyl-6-methylidenecyclohexa-1,4-diene-1,4-diol (PubChem CID 54074805) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is 3-(chloromethylidene)-2,5-dimethyl-6-methylidenecyclohexa-1,4-diene-1,4-diol.
| Compound Name | 3-(chloromethylidene)-2,5-dimethyl-6-methylidenecyclohexa-1,4-diene-1,4-diol |
|---|---|
| PubChem CID | 54074805 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3-(chloromethylidene)-2,5-dimethyl-6-methylidenecyclohexa-1,4-diene-1,4-diol |
| SMILES | C=c1c(C)c(O)c(=CCl)c(C)c1O |
| InChI | InChI=1S/C10H11ClO2/c1-5-6(2)10(13)8(4-11)7(3)9(5)12/h4,12-13H,1H2,2-3H3 |
| InChIKey | MIXWTLAPMXKXJB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|