C15H17N3 — CID 57124859
5,6-bis(2,5-dihydropyridin-6-yl)-2,5-dihydropyridine (PubChem CID 57124859) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 5,6-bis(2,5-dihydropyridin-6-yl)-2,5-dihydropyridine.
| Compound Name | 5,6-bis(2,5-dihydropyridin-6-yl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 57124859 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 5,6-bis(2,5-dihydropyridin-6-yl)-2,5-dihydropyridine |
| SMILES | C1=CCC(C2=NCC=CC2C2=NCC=CC2)=NC1 |
| InChI | InChI=1S/C15H17N3/c1-3-9-16-13(7-1)12-6-5-11-18-15(12)14-8-2-4-10-17-14/h1-6,12H,7-11H2 |
| InChIKey | XGKDZABXYYEXRD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|